CAS 1256834-25-9 appears in our catalog under these names: 2-Methyl-5-phenylpyridin-3-amine, 97%, 2-Methyl-5-phenylpyridin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-5-phenylpyridin-3-amine (CAS 1256834-25-9) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 2-methyl-5-phenylpyridin-3-amine. InChIKey: VZAGXOBOKSVVJK-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 2-methyl-5-phenylpyridin-3-amine |
| InChIKey | VZAGXOBOKSVVJK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)