Products 1256956-70-3
CAS 1256956-70-3 appears in our catalog under these names: 5-Bromo-2-(difluoromethyl)-1h-1,3-benzodiazole, 95%, 5-Bromo-2-(difluoromethyl)-1H-benzimidazole, 98%, 5-Bromo-2-(difluoromethyl)-1H-1,3-benzodiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
6-bromo-2-(difluoromethyl)-1H-benzimidazole (CAS 1256956-70-3) is a chemical compound with the molecular formula C8H5BrF2N2 and a molecular weight of 247.04 g/mol. IUPAC name: 6-bromo-2-(difluoromethyl)-1H-benzimidazole. InChIKey: DNVWMFVLIONESY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2N2 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | 6-bromo-2-(difluoromethyl)-1H-benzimidazole |
| InChIKey | DNVWMFVLIONESY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=N2)C(F)F |
Computed by PubChem (NCBI)