Products 2407081-98-3
CAS 2407081-98-3 is the registry number for 5-Bromo-6,7-difluoro-3-methyl-1H-indazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6,7-difluoro-3-methyl-2H-indazole (CAS 2407081-98-3) is a chemical compound with the molecular formula C8H5BrF2N2 and a molecular weight of 247.04 g/mol. IUPAC name: 5-bromo-6,7-difluoro-3-methyl-2H-indazole. InChIKey: CGAVORORLYJCKV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2N2 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | 5-bromo-6,7-difluoro-3-methyl-2H-indazole |
| InChIKey | CGAVORORLYJCKV-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C(=C(C2=NN1)F)F)Br |
Computed by PubChem (NCBI)