Products 1257-19-8
CAS 1257-19-8 appears in our catalog under these names: Trimetazidine EP Impurity B, Trimetazidine Impurity 2（Trimetazidine EP Impurity B), Hexametazidine, >95% (HPLC), 1,4-Bis(2,3,4-trimethoxybenzyl)piperazine, Trimetazidine impurity 3. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
1,4-bis[(2,3,4-trimethoxyphenyl)methyl]piperazine (CAS 1257-19-8) is a chemical compound with the molecular formula C24H34N2O6 and a molecular weight of 446.5 g/mol. IUPAC name: 1,4-bis[(2,3,4-trimethoxyphenyl)methyl]piperazine. InChIKey: SZYPCHFFOGTJQE-UHFFFAOYSA-N.
| Molecular formula | C24H34N2O6 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 1,4-bis[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| InChIKey | SZYPCHFFOGTJQE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CN2CCN(CC2)CC3=C(C(=C(C=C3)OC)OC)OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Hexametazidine, 1,4-bis(2,3,4-trimethoxybenzyl)piperazine, 1,4-bis[(2,3,4-trimethoxyphenyl)methyl]piperazine, 1,4-Bis((2,3,4-trimethoxyphenyl)methyl)piperazine, Piperazine, 1,4-bis((2,3,4-trimethoxyphenyl)methyl)-, Trimetazidine dihydrochloride impurity B [EP], Trimetazidine dihydrochloride impurity B, TRIMETAZIDINE DIHYDROCHLORIDE IMPURITY B [EP IMPURITY], TRIMETAZIDINE DIHYDROCHLORIDE IMPURITY B (EP IMPURITY), Trimetazidine EP Impurity B