CAS 333749-57-8 appears in our catalog under these names: Ranolazine HCl Impurity C, Ranolazine Impurity 19, Ranolazine Impurity 3, α,α'-Bis((2-methoxyphenoxy)methyl)-1,4-piperazinediethanol, RANOLAZINE ALCOHOL DIMER. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, Get quote.
1-[4-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperazin-1-yl]-3-(2-methoxyphenoxy)propan-2-ol (CAS 333749-57-8) is a chemical compound with the molecular formula C24H34N2O6 and a molecular weight of 446.5 g/mol. IUPAC name: 1-[4-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperazin-1-yl]-3-(2-methoxyphenoxy)propan-2-ol. InChIKey: SBVOXBJBJCUZFP-UHFFFAOYSA-N.
| Molecular formula | C24H34N2O6 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 1-[4-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperazin-1-yl]-3-(2-methoxyphenoxy)propan-2-ol |
| InChIKey | SBVOXBJBJCUZFP-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OCC(CN2CCN(CC2)CC(COC3=CC=CC=C3OC)O)O |
Computed by PubChem (NCBI)