Products 1257228-26-4

CAS 1257228-26-4 is the registry number for Amoitone B, 98.50%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

Pentyl 2-(3,5-dihydroxy-2-nonanoylphenyl)acetate (CAS 1257228-26-4) is a chemical compound with the molecular formula C22H34O5 and a molecular weight of 378.5 g/mol. IUPAC name: pentyl 2-(3,5-dihydroxy-2-nonanoylphenyl)acetate. InChIKey: FCKDHZVFIMRCNM-UHFFFAOYSA-N.

Identity
Molecular formulaC22H34O5
Molecular weight378.5 g/mol
IUPAC namepentyl 2-(3,5-dihydroxy-2-nonanoylphenyl)acetate
InChIKeyFCKDHZVFIMRCNM-UHFFFAOYSA-N
SMILESCCCCCCCCC(=O)C1=C(C=C(C=C1O)O)CC(=O)OCCCCC

Computed by PubChem (NCBI)