Products 2093111-29-4
CAS 2093111-29-4 appears in our catalog under these names: Resolvin D2 n-3 DPA, Resolvin D2 n–3 DPA. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10ug, 25ug, 50ug, 100ug, 10μg, 100μg, 25μg, 50μg.
(7S,8E,10Z,12E,14E,16R,17S,19Z)-7,16,17-trihydroxydocosa-8,10,12,14,19-pentaenoic acid (CAS 2093111-29-4) is a chemical compound with the molecular formula C22H34O5 and a molecular weight of 378.5 g/mol. IUPAC name: (7S,8E,10Z,12E,14E,16R,17S,19Z)-7,16,17-trihydroxydocosa-8,10,12,14,19-pentaenoic acid. InChIKey: LDVCZYSUILUYKN-BGERNTNVSA-N.
| Molecular formula | C22H34O5 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | (7S,8E,10Z,12E,14E,16R,17S,19Z)-7,16,17-trihydroxydocosa-8,10,12,14,19-pentaenoic acid |
| InChIKey | LDVCZYSUILUYKN-BGERNTNVSA-N |
| SMILES | CC/C=C\C[C@@H]([C@@H](/C=C/C=C/C=C\C=C\[C@H](CCCCCC(=O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Resolvin D2 n-3 DPA, orb1984975