CAS 1257294-09-9 is the registry number for tert-Butyl 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
Tert-butyl 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylate (CAS 1257294-09-9) is a chemical compound with the molecular formula C12H20F2N2O2 and a molecular weight of 262.30 g/mol. IUPAC name: tert-butyl 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylate. InChIKey: JCSMXSJXCVDXDS-UHFFFAOYSA-N.
| Molecular formula | C12H20F2N2O2 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | tert-butyl 3-(3,3-difluoropyrrolidin-1-yl)azetidine-1-carboxylate |
| InChIKey | JCSMXSJXCVDXDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)N2CCC(C2)(F)F |
Computed by PubChem (NCBI)