Products 2768872-82-6
CAS 2768872-82-6 is the registry number for tert-Butyl 7-(difluoromethyl)-2,6-diazaspiro[3.4]octane-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-(difluoromethyl)-2,7-diazaspiro[3.4]octane-2-carboxylate (CAS 2768872-82-6) is a chemical compound with the molecular formula C12H20F2N2O2 and a molecular weight of 262.30 g/mol. IUPAC name: tert-butyl 6-(difluoromethyl)-2,7-diazaspiro[3.4]octane-2-carboxylate. InChIKey: XXSWNXYKFMJULT-UHFFFAOYSA-N.
| Molecular formula | C12H20F2N2O2 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | tert-butyl 6-(difluoromethyl)-2,7-diazaspiro[3.4]octane-2-carboxylate |
| InChIKey | XXSWNXYKFMJULT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(NC2)C(F)F |
Computed by PubChem (NCBI)