CAS 1257530-02-1 is the registry number for 5-(tert-Butoxy)-1,2,3-trifluorobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3-trifluoro-5-[(2-methylpropan-2-yl)oxy]benzene (CAS 1257530-02-1) is a chemical compound with the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. IUPAC name: 1,2,3-trifluoro-5-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: FHQMAIOEDPFJPO-UHFFFAOYSA-N.
| Molecular formula | C10H11F3O |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1,2,3-trifluoro-5-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | FHQMAIOEDPFJPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC(=C(C(=C1)F)F)F |
Computed by PubChem (NCBI)