CAS 2359693-76-6 is the registry number for (S)-1-(3-(1,1-Difluoroethyl)-2-fluorophenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3-(1,1-difluoroethyl)-2-fluorophenyl]ethanol (CAS 2359693-76-6) is a chemical compound with the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. IUPAC name: (1S)-1-[3-(1,1-difluoroethyl)-2-fluorophenyl]ethanol. InChIKey: WBTYSVQPUYQTFU-LURJTMIESA-N.
| Molecular formula | C10H11F3O |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | (1S)-1-[3-(1,1-difluoroethyl)-2-fluorophenyl]ethanol |
| InChIKey | WBTYSVQPUYQTFU-LURJTMIESA-N |
| SMILES | C[C@@H](C1=C(C(=CC=C1)C(C)(F)F)F)O |
Computed by PubChem (NCBI)