CAS 1257531-11-5 is the registry number for 2-(3-Bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257531-11-5) is a chemical compound with the molecular formula C11H11BBrNO4 and a molecular weight of 311.93 g/mol. IUPAC name: 2-(3-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: OTMWVBFJNBHZLV-UHFFFAOYSA-N.
| Molecular formula | C11H11BBrNO4 |
|---|---|
| Molecular weight | 311.93 g/mol |
| IUPAC name | 2-(3-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | OTMWVBFJNBHZLV-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)