Products 943552-28-1

CAS 943552-28-1 is the registry number for 2-Bromophenylboronic acid mida ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 943552-28-1) is a chemical compound with the molecular formula C11H11BBrNO4 and a molecular weight of 311.93 g/mol. IUPAC name: 2-(2-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: OKCCXZGVZLOVRX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BBrNO4
Molecular weight311.93 g/mol
IUPAC name2-(2-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione
InChIKeyOKCCXZGVZLOVRX-UHFFFAOYSA-N
SMILESB1(OC(=O)CN(CC(=O)O1)C)C2=CC=CC=C2Br

Computed by PubChem (NCBI)