Products 1257535-05-9
CAS 1257535-05-9 is the registry number for 2-Methyl-6-(trifluoromethyl)pyridine-3-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-methyl-6-(trifluoromethyl)pyridine-3-sulfonyl chloride (CAS 1257535-05-9) is a chemical compound with the molecular formula C7H5ClF3NO2S and a molecular weight of 259.63 g/mol. IUPAC name: 2-methyl-6-(trifluoromethyl)pyridine-3-sulfonyl chloride. InChIKey: BNCNLCKWRCXBQH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO2S |
|---|---|
| Molecular weight | 259.63 g/mol |
| IUPAC name | 2-methyl-6-(trifluoromethyl)pyridine-3-sulfonyl chloride |
| InChIKey | BNCNLCKWRCXBQH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)