Products 23384-02-3
CAS 23384-02-3 is the registry number for N-(2-Chlorophenyl)-1,1,1-trifluoro-methanesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
N-(2-chlorophenyl)-1,1,1-trifluoromethanesulfonamide (CAS 23384-02-3) is a chemical compound with the molecular formula C7H5ClF3NO2S and a molecular weight of 259.63 g/mol. IUPAC name: N-(2-chlorophenyl)-1,1,1-trifluoromethanesulfonamide. InChIKey: HGKHMTFZPUNOHB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO2S |
|---|---|
| Molecular weight | 259.63 g/mol |
| IUPAC name | N-(2-chlorophenyl)-1,1,1-trifluoromethanesulfonamide |
| InChIKey | HGKHMTFZPUNOHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NS(=O)(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)