Products 1257542-38-3
CAS 1257542-38-3 is the registry number for CaMdr1p-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-anilino-4-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione (CAS 1257542-38-3) is a chemical compound with the molecular formula C22H20N2O2 and a molecular weight of 344.4 g/mol. IUPAC name: 3-anilino-4-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione. InChIKey: GHIMFDNERWLZKB-QGOAFFKASA-N.
| Molecular formula | C22H20N2O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 3-anilino-4-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione |
| InChIKey | GHIMFDNERWLZKB-QGOAFFKASA-N |
| SMILES | CC\1(C2=CC=CC=C2N(/C1=C/C3=C(C(=O)C3=O)NC4=CC=CC=C4)C)C |
Computed by PubChem (NCBI)