Products 1257637-94-7
CAS 1257637-94-7 is the registry number for 1-(5-Iodopyridin-2-yl)cyclobutanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(5-iodo-2-pyridinyl)cyclobutane-1-carboxylic acid (CAS 1257637-94-7) is a chemical compound with the molecular formula C10H10INO2 and a molecular weight of 303.10 g/mol. IUPAC name: 1-(5-iodo-2-pyridinyl)cyclobutane-1-carboxylic acid. InChIKey: VOLCXOWPTGJRKH-UHFFFAOYSA-N.
| Molecular formula | C10H10INO2 |
|---|---|
| Molecular weight | 303.10 g/mol |
| IUPAC name | 1-(5-iodo-2-pyridinyl)cyclobutane-1-carboxylic acid |
| InChIKey | VOLCXOWPTGJRKH-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=NC=C(C=C2)I)C(=O)O |
Computed by PubChem (NCBI)