Products 2714000-75-4
CAS 2714000-75-4 is the registry number for 3-Iodo-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-iodo-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-6-carboxylic acid (CAS 2714000-75-4) is a chemical compound with the molecular formula C10H10INO2 and a molecular weight of 303.10 g/mol. IUPAC name: 3-iodo-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-6-carboxylic acid. InChIKey: POLDROGYNNTJSB-UHFFFAOYSA-N.
| Molecular formula | C10H10INO2 |
|---|---|
| Molecular weight | 303.10 g/mol |
| IUPAC name | 3-iodo-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-6-carboxylic acid |
| InChIKey | POLDROGYNNTJSB-UHFFFAOYSA-N |
| SMILES | CC1=C2CC(CC2=CC(=N1)I)C(=O)O |
Computed by PubChem (NCBI)