Products 1257664-90-6
CAS 1257664-90-6 is the registry number for 1-(4-Bromo-3-trifluoromethylphenyl)piperidin-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-[4-bromo-3-(trifluoromethyl)phenyl]piperidin-2-one (CAS 1257664-90-6) is a chemical compound with the molecular formula C12H11BrF3NO and a molecular weight of 322.12 g/mol. IUPAC name: 1-[4-bromo-3-(trifluoromethyl)phenyl]piperidin-2-one. InChIKey: LTVWQJQBGMWUKJ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrF3NO |
|---|---|
| Molecular weight | 322.12 g/mol |
| IUPAC name | 1-[4-bromo-3-(trifluoromethyl)phenyl]piperidin-2-one |
| InChIKey | LTVWQJQBGMWUKJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)