Products 1508181-18-7
CAS 1508181-18-7 is the registry number for 4-Bromo-n-cyclobutyl-3-(trifluoromethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-N-cyclobutyl-3-(trifluoromethyl)benzamide (CAS 1508181-18-7) is a chemical compound with the molecular formula C12H11BrF3NO and a molecular weight of 322.12 g/mol. IUPAC name: 4-bromo-N-cyclobutyl-3-(trifluoromethyl)benzamide. InChIKey: FLUDXBWURPFZKB-UHFFFAOYSA-N.
| Molecular formula | C12H11BrF3NO |
|---|---|
| Molecular weight | 322.12 g/mol |
| IUPAC name | 4-bromo-N-cyclobutyl-3-(trifluoromethyl)benzamide |
| InChIKey | FLUDXBWURPFZKB-UHFFFAOYSA-N |
| SMILES | C1CC(C1)NC(=O)C2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)