Products 125772-35-2

CAS 125772-35-2 appears in our catalog under these names: 2-(5-Bromo-2-thienyl)acetyl chloride, 95%, 2-(5-Bromothiophen-2-yl)acetyl chloride, 98%, 2-(5-BROMO-2-THIENYL)ACETYL CHLORIDE, ≥95%, 2-(5-Bromo-2-thienyl)acetyl Chloride, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(5-bromothiophen-2-yl)acetyl chloride (CAS 125772-35-2) is a chemical compound with the molecular formula C6H4BrClOS and a molecular weight of 239.52 g/mol. IUPAC name: 2-(5-bromothiophen-2-yl)acetyl chloride. InChIKey: SZUWDICEXLUJQU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrClOS
Molecular weight239.52 g/mol
IUPAC name2-(5-bromothiophen-2-yl)acetyl chloride
InChIKeySZUWDICEXLUJQU-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)Br)CC(=O)Cl

Computed by PubChem (NCBI)