Products 265652-36-6

CAS 265652-36-6 appears in our catalog under these names: 4-Bromo-3-methylthiophene-2-carbonyl chloride, 97%, 4-Bromo-3-methylthiophenecarbonyl chloride. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.

4-bromo-3-methylthiophene-2-carbonyl chloride (CAS 265652-36-6) is a chemical compound with the molecular formula C6H4BrClOS and a molecular weight of 239.52 g/mol. IUPAC name: 4-bromo-3-methylthiophene-2-carbonyl chloride. InChIKey: LQDVGTOWGBSXPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrClOS
Molecular weight239.52 g/mol
IUPAC name4-bromo-3-methylthiophene-2-carbonyl chloride
InChIKeyLQDVGTOWGBSXPJ-UHFFFAOYSA-N
SMILESCC1=C(SC=C1Br)C(=O)Cl

Computed by PubChem (NCBI)