CAS 125773-94-6 appears in our catalog under these names: 3,6–Diethylphthalonitrile, 3,6-Diethylphthalonitrile 99%, 3,6-Diethylphthalonitrile, 99%, 99%, 3,6-Diethylphthalonitrile, 99%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
3,6-diethylbenzene-1,2-dicarbonitrile (CAS 125773-94-6) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. IUPAC name: 3,6-diethylbenzene-1,2-dicarbonitrile. InChIKey: AENCVFZQMQUYSJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | 3,6-diethylbenzene-1,2-dicarbonitrile |
| InChIKey | AENCVFZQMQUYSJ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1)CC)C#N)C#N |
Computed by PubChem (NCBI)