CAS 1257793-03-5 appears in our catalog under these names: 3,5-Difluoro-4-iodophenylboronic acid, 95%, (3,5-Difluoro-4-iodophenyl)boronic acid, 95+%, 3,5-Difluoro-4-iodophenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(3,5-difluoro-4-iodophenyl)boronic acid (CAS 1257793-03-5) is a chemical compound with the molecular formula C6H4BF2IO2 and a molecular weight of 283.81 g/mol. IUPAC name: (3,5-difluoro-4-iodophenyl)boronic acid. InChIKey: LSFYAVLDQLEKJH-UHFFFAOYSA-N.
| Molecular formula | C6H4BF2IO2 |
|---|---|
| Molecular weight | 283.81 g/mol |
| IUPAC name | (3,5-difluoro-4-iodophenyl)boronic acid |
| InChIKey | LSFYAVLDQLEKJH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)I)F)(O)O |
Computed by PubChem (NCBI)