CAS 1451393-12-6 appears in our catalog under these names: 2,4-Difluoro-3-iodophenylboronic acid, 97%, (2,4-Difluoro-3-iodophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 250mg.
(2,4-difluoro-3-iodophenyl)boronic acid (CAS 1451393-12-6) is a chemical compound with the molecular formula C6H4BF2IO2 and a molecular weight of 283.81 g/mol. IUPAC name: (2,4-difluoro-3-iodophenyl)boronic acid. InChIKey: GJEPANJRXYVOIH-UHFFFAOYSA-N.
| Molecular formula | C6H4BF2IO2 |
|---|---|
| Molecular weight | 283.81 g/mol |
| IUPAC name | (2,4-difluoro-3-iodophenyl)boronic acid |
| InChIKey | GJEPANJRXYVOIH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)I)F)(O)O |
Computed by PubChem (NCBI)