Products 1257842-67-3

CAS 1257842-67-3 is the registry number for 4-bromo-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-bromo-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid (CAS 1257842-67-3) is a chemical compound with the molecular formula C5H2BrF3N2O2 and a molecular weight of 258.98 g/mol. IUPAC name: 4-bromo-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid. InChIKey: CXCYQTXIWGFXEE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2BrF3N2O2
Molecular weight258.98 g/mol
IUPAC name4-bromo-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid
InChIKeyCXCYQTXIWGFXEE-UHFFFAOYSA-N
SMILESC1(=C(NN=C1C(=O)O)C(F)(F)F)Br

Computed by PubChem (NCBI)