CAS 26676-21-1 appears in our catalog under these names: 5–Bromo–6–(trifluoromethyl)pyrimidine–2,4(1H,3H)–dione, 5-Bromo-6-(trifluoromethyl)pyrimidine-2,4(1H,3H)-dione. Offered by: GLPBio, Biosynth. Available pack sizes: 50mg, 0,5g, 5g.
5-bromo-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (CAS 26676-21-1) is a chemical compound with the molecular formula C5H2BrF3N2O2 and a molecular weight of 258.98 g/mol. IUPAC name: 5-bromo-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione. InChIKey: QHDBWBYMRZBYCI-UHFFFAOYSA-N.
| Molecular formula | C5H2BrF3N2O2 |
|---|---|
| Molecular weight | 258.98 g/mol |
| IUPAC name | 5-bromo-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | QHDBWBYMRZBYCI-UHFFFAOYSA-N |
| SMILES | C1(=C(NC(=O)NC1=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)