CAS 1257844-57-7 appears in our catalog under these names: 5,6,7-Trifluoro-2,3-dihydro-1H-inden-1-one, 5,6,7-Trifluoro-2,3-dihydro-1H-inden-1-one, 97%, 97%, 5,6,7-Trifluoro-2,3-dihydro-1h-inden-1-one, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5,6,7-trifluoro-2,3-dihydroinden-1-one (CAS 1257844-57-7) is a chemical compound with the molecular formula C9H5F3O and a molecular weight of 186.13 g/mol. IUPAC name: 5,6,7-trifluoro-2,3-dihydroinden-1-one. InChIKey: JIAZZRGVQRLEPU-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 5,6,7-trifluoro-2,3-dihydroinden-1-one |
| InChIKey | JIAZZRGVQRLEPU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C(=C(C=C21)F)F)F |
Computed by PubChem (NCBI)