Products 857722-21-5
CAS 857722-21-5 is the registry number for (E)-3-(3,4,5-Trifluorophenyl)acrylaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(3,4,5-trifluorophenyl)prop-2-enal (CAS 857722-21-5) is a chemical compound with the molecular formula C9H5F3O and a molecular weight of 186.13 g/mol. IUPAC name: (E)-3-(3,4,5-trifluorophenyl)prop-2-enal. InChIKey: FLHLOBFJEBDFFX-OWOJBTEDSA-N.
| Molecular formula | C9H5F3O |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | (E)-3-(3,4,5-trifluorophenyl)prop-2-enal |
| InChIKey | FLHLOBFJEBDFFX-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)/C=C/C=O |
Computed by PubChem (NCBI)