CAS 1257877-25-0 appears in our catalog under these names: 3-Ethyl-5-(thiophen-3-yl)-1h-pyrazol-4-amine, 95%, 5-Ethyl-3-(thiophen-3-yl)-1H-pyrazol-4-amine, 95+%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-ethyl-3-thiophen-3-yl-1H-pyrazol-4-amine (CAS 1257877-25-0) is a chemical compound with the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. IUPAC name: 5-ethyl-3-thiophen-3-yl-1H-pyrazol-4-amine. InChIKey: ZCQRWXMKLNFBST-UHFFFAOYSA-N.
| Molecular formula | C9H11N3S |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | 5-ethyl-3-thiophen-3-yl-1H-pyrazol-4-amine |
| InChIKey | ZCQRWXMKLNFBST-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NN1)C2=CSC=C2)N |
Computed by PubChem (NCBI)