CAS 64334-41-4 is the registry number for N6,N6-Dimethyl-1,3-benzothiazole-2,6-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine (CAS 64334-41-4) is a chemical compound with the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. IUPAC name: 6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine. InChIKey: DCUFLOLNQPJBDW-UHFFFAOYSA-N.
| Molecular formula | C9H11N3S |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | 6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine |
| InChIKey | DCUFLOLNQPJBDW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)N=C(S2)N |
Computed by PubChem (NCBI)