CAS 1257878-84-4 is the registry number for 4-(2-Fluorophenyl)-3-methyl-1H-pyrazol-5-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
4-(2-fluorophenyl)-5-methyl-1H-pyrazol-3-amine;hydrochloride (CAS 1257878-84-4) is a chemical compound with the molecular formula C10H11ClFN3 and a molecular weight of 227.66 g/mol. IUPAC name: 4-(2-fluorophenyl)-5-methyl-1H-pyrazol-3-amine;hydrochloride. InChIKey: JWUMIEJQWHKXJC-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFN3 |
|---|---|
| Molecular weight | 227.66 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-5-methyl-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | JWUMIEJQWHKXJC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)N)C2=CC=CC=C2F.Cl |
Computed by PubChem (NCBI)