Products 1258651-51-2
CAS 1258651-51-2 appears in our catalog under these names: 1-[(2-Fluorophenyl)methyl]-1h-pyrazol-5-amine hydrochloride, 95%, 1-((2-Fluorophenyl)methyl)-1H-pyrazol-5-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
2-[(2-fluorophenyl)methyl]pyrazol-3-amine;hydrochloride (CAS 1258651-51-2) is a chemical compound with the molecular formula C10H11ClFN3 and a molecular weight of 227.66 g/mol. IUPAC name: 2-[(2-fluorophenyl)methyl]pyrazol-3-amine;hydrochloride. InChIKey: AQTIYPDERPJVCR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFN3 |
|---|---|
| Molecular weight | 227.66 g/mol |
| IUPAC name | 2-[(2-fluorophenyl)methyl]pyrazol-3-amine;hydrochloride |
| InChIKey | AQTIYPDERPJVCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C(=CC=N2)N)F.Cl |
Computed by PubChem (NCBI)