CAS 1258459-49-2 appears in our catalog under these names: 2,7-DIBROMOBENZO[1,2-B:6,5-B']DITHIOPHENE-4,5-DIONE, 97%, 97%, 2,7-Dibromobenzo[2,1-b:3,4-b']dithiophene-4,5-dione, 97%, 2,7-Dibromobenzo[1,2-b:6,5-b']dithiophene-4,5-dione, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,7-dibromothieno[3,2-g][1]benzothiole-4,5-dione (CAS 1258459-49-2) is a chemical compound with the molecular formula C10H2Br2O2S2 and a molecular weight of 378.1 g/mol. IUPAC name: 2,7-dibromothieno[3,2-g][1]benzothiole-4,5-dione. InChIKey: LKBSNQXXSMCHSS-UHFFFAOYSA-N.
| Molecular formula | C10H2Br2O2S2 |
|---|---|
| Molecular weight | 378.1 g/mol |
| IUPAC name | 2,7-dibromothieno[3,2-g][1]benzothiole-4,5-dione |
| InChIKey | LKBSNQXXSMCHSS-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=O)C(=O)C3=C2SC(=C3)Br)Br |
Computed by PubChem (NCBI)