CAS 196491-93-7 appears in our catalog under these names: 2,6–Dibromobenzo(1,2–b:4,5–b')dithiophene–4,8–dione, 2,6-Dibromobenzo[1,2-b:4,5-b']dithiophene-4,8-dione, 97% (stabilized with Cu+HQ+MgO), 97% (stabilized with Cu+HQ+MgO), 2,6-Dibromobenzo[1,2-b:4,5-b']dithiophene-4,8-dione, 97% (stabilized with Cu+HQ+MgO). Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
2,6-dibromothieno[2,3-f][1]benzothiole-4,8-dione (CAS 196491-93-7) is a chemical compound with the molecular formula C10H2Br2O2S2 and a molecular weight of 378.1 g/mol. IUPAC name: 2,6-dibromothieno[2,3-f][1]benzothiole-4,8-dione. InChIKey: SHUYYKQUFOHRKK-UHFFFAOYSA-N.
| Molecular formula | C10H2Br2O2S2 |
|---|---|
| Molecular weight | 378.1 g/mol |
| IUPAC name | 2,6-dibromothieno[2,3-f][1]benzothiole-4,8-dione |
| InChIKey | SHUYYKQUFOHRKK-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=O)C3=C(C2=O)C=C(S3)Br)Br |
Computed by PubChem (NCBI)