Products 1258513-40-4
CAS 1258513-40-4 appears in our catalog under these names: UBS109, UBS109, 99.20%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 50 mg.
(3E,5E)-1-methyl-3,5-bis(pyridin-2-ylmethylidene)piperidin-4-one (CAS 1258513-40-4) is a chemical compound with the molecular formula C18H17N3O and a molecular weight of 291.3 g/mol. IUPAC name: (3E,5E)-1-methyl-3,5-bis(pyridin-2-ylmethylidene)piperidin-4-one. InChIKey: VCLPNFMJSSBBKX-WFYKWJGLSA-N.
| Molecular formula | C18H17N3O |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | (3E,5E)-1-methyl-3,5-bis(pyridin-2-ylmethylidene)piperidin-4-one |
| InChIKey | VCLPNFMJSSBBKX-WFYKWJGLSA-N |
| SMILES | CN1C/C(=C\C2=CC=CC=N2)/C(=O)/C(=C/C3=CC=CC=N3)/C1 |
Computed by PubChem (NCBI)