CAS 330998-71-5 is the registry number for 3-(5,5-Dimethyl-5,6-dihydro[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)phenol (CAS 330998-71-5) is a chemical compound with the molecular formula C18H17N3O and a molecular weight of 291.3 g/mol. IUPAC name: 3-(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)phenol. InChIKey: OUNBBIYHRZELDA-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 3-(5,5-dimethyl-6H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl)phenol |
| InChIKey | OUNBBIYHRZELDA-UHFFFAOYSA-N |
| SMILES | CC1(CC2=CC=CC=C2C3=NN=C(N31)C4=CC(=CC=C4)O)C |
Computed by PubChem (NCBI)