CAS 1258639-39-2 appears in our catalog under these names: 3-{(2-(2-Fluorophenyl)-2-oxoethyl)carbamoyl}propanoic acid, 3-([2-(2-Fluorophenyl)-2-oxoethyl]carbamoyl)propanoic acid, 95%, 3-{(2-(2-fluorophenyl)-2-oxoethyl)carbamoyl}propanoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
4-[[2-(2-fluorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid (CAS 1258639-39-2) is a chemical compound with the molecular formula C12H12FNO4 and a molecular weight of 253.23 g/mol. IUPAC name: 4-[[2-(2-fluorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid. InChIKey: DTKPEFCOFMCEED-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO4 |
|---|---|
| Molecular weight | 253.23 g/mol |
| IUPAC name | 4-[[2-(2-fluorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid |
| InChIKey | DTKPEFCOFMCEED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CNC(=O)CCC(=O)O)F |
Computed by PubChem (NCBI)