CAS 1326813-45-9 is the registry number for 3-(4-Fluoro-3-methoxyphenyl)-5-methyl-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (CAS 1326813-45-9) is a chemical compound with the molecular formula C12H12FNO4 and a molecular weight of 253.23 g/mol. IUPAC name: 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid. InChIKey: AAQNKNMAFSDHEM-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO4 |
|---|---|
| Molecular weight | 253.23 g/mol |
| IUPAC name | 3-(4-fluoro-3-methoxyphenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid |
| InChIKey | AAQNKNMAFSDHEM-UHFFFAOYSA-N |
| SMILES | CC1(CC(=NO1)C2=CC(=C(C=C2)F)OC)C(=O)O |
Computed by PubChem (NCBI)