Products 1258639-84-7
CAS 1258639-84-7 appears in our catalog under these names: 2-Chloro-n-[2-(2,4,6-trimethylphenyl)ethyl]acetamide, 95%, 2-Chloro-N-(2-(2,4,6-trimethylphenyl)ethyl)acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-chloro-N-[2-(2,4,6-trimethylphenyl)ethyl]acetamide (CAS 1258639-84-7) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 2-chloro-N-[2-(2,4,6-trimethylphenyl)ethyl]acetamide. InChIKey: ISPQJNQZIHRDBZ-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 2-chloro-N-[2-(2,4,6-trimethylphenyl)ethyl]acetamide |
| InChIKey | ISPQJNQZIHRDBZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CCNC(=O)CCl)C |
Computed by PubChem (NCBI)