CAS 1258641-16-5 appears in our catalog under these names: N-tert-Butyl-2-chloro-N-((3-fluorophenyl)methyl)acetamide, 95%, N-tert-Butyl-2-chloro-N-((3-fluorophenyl)methyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-tert-butyl-2-chloro-N-[(3-fluorophenyl)methyl]acetamide (CAS 1258641-16-5) is a chemical compound with the molecular formula C13H17ClFNO and a molecular weight of 257.73 g/mol. IUPAC name: N-tert-butyl-2-chloro-N-[(3-fluorophenyl)methyl]acetamide. InChIKey: NDPWEBDHZUVUKM-UHFFFAOYSA-N.
| Molecular formula | C13H17ClFNO |
|---|---|
| Molecular weight | 257.73 g/mol |
| IUPAC name | N-tert-butyl-2-chloro-N-[(3-fluorophenyl)methyl]acetamide |
| InChIKey | NDPWEBDHZUVUKM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(CC1=CC(=CC=C1)F)C(=O)CCl |
Computed by PubChem (NCBI)