Products 1492905-06-2
CAS 1492905-06-2 is the registry number for 2-Chloro-4-fluoro-N,N-bis(1-methylethyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-chloro-4-fluoro-N,N-di(propan-2-yl)benzamide (CAS 1492905-06-2) is a chemical compound with the molecular formula C13H17ClFNO and a molecular weight of 257.73 g/mol. IUPAC name: 2-chloro-4-fluoro-N,N-di(propan-2-yl)benzamide. InChIKey: XHPDXJVCWQXGNC-UHFFFAOYSA-N.
| Molecular formula | C13H17ClFNO |
|---|---|
| Molecular weight | 257.73 g/mol |
| IUPAC name | 2-chloro-4-fluoro-N,N-di(propan-2-yl)benzamide |
| InChIKey | XHPDXJVCWQXGNC-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=C(C=C(C=C1)F)Cl |
Computed by PubChem (NCBI)