CAS 1258641-44-9 appears in our catalog under these names: 3-{imidazo(1,2-a)pyridin-2-ylmethoxy}aniline dihydrochloride, 95%, 3-{Imidazo(1,2-a)pyridin-2-ylmethoxy}aniline dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)aniline;dihydrochloride (CAS 1258641-44-9) is a chemical compound with the molecular formula C14H15Cl2N3O and a molecular weight of 312.2 g/mol. IUPAC name: 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)aniline;dihydrochloride. InChIKey: PQXBHFJTKDYAKM-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3O |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)aniline;dihydrochloride |
| InChIKey | PQXBHFJTKDYAKM-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)COC3=CC=CC(=C3)N.Cl.Cl |
Computed by PubChem (NCBI)