Products 650615-56-8
CAS 650615-56-8 is the registry number for 2-(4,5-Dichloro-1H-imidazol-1-yl)-N-(4-isopropylphenyl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,5-dichloroimidazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide (CAS 650615-56-8) is a chemical compound with the molecular formula C14H15Cl2N3O and a molecular weight of 312.2 g/mol. IUPAC name: 2-(4,5-dichloroimidazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide. InChIKey: GTJJCWXFNLCPFH-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3O |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | 2-(4,5-dichloroimidazol-1-yl)-N-(4-propan-2-ylphenyl)acetamide |
| InChIKey | GTJJCWXFNLCPFH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC(=O)CN2C=NC(=C2Cl)Cl |
Computed by PubChem (NCBI)