Products 1258649-26-1
CAS 1258649-26-1 is the registry number for N-((5-Chlorothiophen-2-yl)methyl)-N,3-dimethylbut-2-enamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethylbut-2-enamide (CAS 1258649-26-1) is a chemical compound with the molecular formula C11H14ClNOS and a molecular weight of 243.75 g/mol. IUPAC name: N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethylbut-2-enamide. InChIKey: URBFORVEIUSEFV-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNOS |
|---|---|
| Molecular weight | 243.75 g/mol |
| IUPAC name | N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethylbut-2-enamide |
| InChIKey | URBFORVEIUSEFV-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)N(C)CC1=CC=C(S1)Cl)C |
Computed by PubChem (NCBI)