CAS 336105-23-8 is the registry number for (R)-N-(4-Chlorobenzylidene)-2-methylpropane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(NE,R)-N-[(4-chlorophenyl)methylidene]-2-methylpropane-2-sulfinamide (CAS 336105-23-8) is a chemical compound with the molecular formula C11H14ClNOS and a molecular weight of 243.75 g/mol. IUPAC name: (NE,R)-N-[(4-chlorophenyl)methylidene]-2-methylpropane-2-sulfinamide. InChIKey: YQAZHKMIBKHOJC-XETPBLJFSA-N.
| Molecular formula | C11H14ClNOS |
|---|---|
| Molecular weight | 243.75 g/mol |
| IUPAC name | (NE,R)-N-[(4-chlorophenyl)methylidene]-2-methylpropane-2-sulfinamide |
| InChIKey | YQAZHKMIBKHOJC-XETPBLJFSA-N |
| SMILES | CC(C)(C)[S@@](=O)/N=C/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)