CAS 1258649-96-5 is the registry number for (3-(Furan-2-yl)-1H-1,2,4-triazol-5-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride (CAS 1258649-96-5) is a chemical compound with the molecular formula C7H9ClN4O and a molecular weight of 200.62 g/mol. IUPAC name: [3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride. InChIKey: LZFWVBLPIWPIAR-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN4O |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | [3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride |
| InChIKey | LZFWVBLPIWPIAR-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NNC(=N2)CN.Cl |
Computed by PubChem (NCBI)