CAS 2241142-24-3 is the registry number for 5-(Aminomethyl)-(1,2,4)triazolo(4,3-a)pyridin-3(2H)-one Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
5-(aminomethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride (CAS 2241142-24-3) is a chemical compound with the molecular formula C7H9ClN4O and a molecular weight of 200.62 g/mol. IUPAC name: 5-(aminomethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride. InChIKey: OFFJIIUFPBRQQE-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN4O |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 5-(aminomethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride |
| InChIKey | OFFJIIUFPBRQQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=O)N2C(=C1)CN.Cl |
Computed by PubChem (NCBI)