CAS 1258650-31-5 appears in our catalog under these names: 7-Fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine hydrochloride, 95%, 7-Fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride (CAS 1258650-31-5) is a chemical compound with the molecular formula C9H11ClFNS and a molecular weight of 219.71 g/mol. IUPAC name: 7-fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride. InChIKey: XDUNWTIOKNRRTR-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNS |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 7-fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine;hydrochloride |
| InChIKey | XDUNWTIOKNRRTR-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(CN1)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)