CAS 1797870-83-7 appears in our catalog under these names: 7-Fluoro-2,3,4,5-tetrahydro-1,5-benzothiazepine hydrochloride, 7-Fluoro-2,3,4,5-tetrahydro-1,5-benzothiazepine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
7-fluoro-2,3,4,5-tetrahydro-1,5-benzothiazepine;hydrochloride (CAS 1797870-83-7) is a chemical compound with the molecular formula C9H11ClFNS and a molecular weight of 219.71 g/mol. IUPAC name: 7-fluoro-2,3,4,5-tetrahydro-1,5-benzothiazepine;hydrochloride. InChIKey: YPYCLPDFMMIIFE-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNS |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 7-fluoro-2,3,4,5-tetrahydro-1,5-benzothiazepine;hydrochloride |
| InChIKey | YPYCLPDFMMIIFE-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=CC(=C2)F)SC1.Cl |
Computed by PubChem (NCBI)